C17H17Cl2N3O2S2 — CID 118440184
(3S,6S,7S,8aR)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile (PubChem CID 118440184) has the molecular formula C17H17Cl2N3O2S2 and a molecular weight of 430.38 g/mol. Its IUPAC name is (3S,6S,7S,8aR)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile.
| Compound Name | (3S,6S,7S,8aR)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
|---|---|
| PubChem CID | 118440184 |
| Molecular Formula | C17H17Cl2N3O2S2 |
| Molecular Weight | 430.38 g/mol |
| Exact Mass | 429.01 |
| IUPAC Name | (3S,6S,7S,8aR)-6-(3,4-dichlorophenyl)-2,3,7-trimethyl-1,4-dioxo-3,8a-bis(sulfanyl)-6,8-dihydropyrrolo[1,2-a]pyrazine-7-carbonitrile |
| SMILES | CN1C(=O)[C@]2(S)C[C@](C)(C#N)[C@H](c3ccc(Cl)c(Cl)c3)N2C(=O)[C@]1(C)S |
| InChI | InChI=1S/C17H17Cl2N3O2S2/c1-15(8-20)7-17(26)14(24)21(3)16(2,25)13(23)22(17)12(15)9-4-5-10(18)11(19)6-9/h4-6,12,25-26H,7H2,1-3H3/t12-,15+,16-,17+/m0/s1 |
| InChIKey | WVIYUTKQMFTCJZ-NKKGCODLSA-N |
| XLogP | 3.54 |
| TPSA | 64.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|