C17H16FN3O2S2 — CID 118440197
(1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile (PubChem CID 118440197) has the molecular formula C17H16FN3O2S2 and a molecular weight of 377.47 g/mol. Its IUPAC name is (1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile.
| Compound Name | (1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
|---|---|
| PubChem CID | 118440197 |
| Molecular Formula | C17H16FN3O2S2 |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.07 |
| IUPAC Name | (1S,3S,4S,7S)-4-(4-fluorophenyl)-3,7,8-trimethyl-6,9-dioxo-10-sulfanylidene-10λ4-thia-5,8-diazatricyclo[5.2.1.01,5]decane-3-carbonitrile |
| SMILES | CN1C(=O)[C@@]23C[C@](C)(C#N)[C@H](c4ccc(F)cc4)N2C(=O)[C@]1(C)S3=S |
| InChI | InChI=1S/C17H16FN3O2S2/c1-15(9-19)8-17-14(23)20(3)16(2,25(17)24)13(22)21(17)12(15)10-4-6-11(18)7-5-10/h4-7,12H,8H2,1-3H3/t12-,15+,16-,17-,25?/m0/s1 |
| InChIKey | UKLWWSZMNSTBTD-CSHMUZLISA-N |
| XLogP | 1.61 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |