C21H25FN2O4S2 — CID 118440228
tert-butyl (1S,3S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate (PubChem CID 118440228) has the molecular formula C21H25FN2O4S2 and a molecular weight of 452.57 g/mol. Its IUPAC name is tert-butyl (1S,3S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate.
| Compound Name | tert-butyl (1S,3S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 118440228 |
| Molecular Formula | C21H25FN2O4S2 |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | tert-butyl (1S,3S,7S)-4-(4-fluorophenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate |
| SMILES | CN1C(=O)[C@@]23C[C@](C)(C(=O)OC(C)(C)C)C(c4ccc(F)cc4)N2C(=O)[C@]1(C)SS3 |
| InChI | InChI=1S/C21H25FN2O4S2/c1-18(2,3)28-17(27)19(4)11-21-16(26)23(6)20(5,29-30-21)15(25)24(21)14(19)12-7-9-13(22)10-8-12/h7-10,14H,11H2,1-6H3/t14?,19-,20-,21-/m0/s1 |
| InChIKey | RYFGBMKCNAKINN-JOYGSARASA-N |
| XLogP | 3.73 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|