C19H21BrN2O5S2 — CID 118440230
methyl (1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate (PubChem CID 118440230) has the molecular formula C19H21BrN2O5S2 and a molecular weight of 501.42 g/mol. Its IUPAC name is methyl (1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate.
| Compound Name | methyl (1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate |
|---|---|
| PubChem CID | 118440230 |
| Molecular Formula | C19H21BrN2O5S2 |
| Molecular Weight | 501.42 g/mol |
| Exact Mass | 500.01 |
| IUPAC Name | methyl (1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carboxylate |
| SMILES | COC(=O)[C@@]1(C)C[C@@]23SS[C@@](C)(C(=O)N2C1c1cc(Br)ccc1OC)N(C)C3=O |
| InChI | InChI=1S/C19H21BrN2O5S2/c1-17(16(25)27-5)9-19-15(24)21(3)18(2,28-29-19)14(23)22(19)13(17)11-8-10(20)6-7-12(11)26-4/h6-8,13H,9H2,1-5H3/t13?,17-,18-,19-/m0/s1 |
| InChIKey | DYKPRCMEWPJTHY-WRCSZKBWSA-N |
| XLogP | 3.19 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|