C18H18BrN3O3S2 — CID 118440237
(1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile (PubChem CID 118440237) has the molecular formula C18H18BrN3O3S2 and a molecular weight of 468.40 g/mol. Its IUPAC name is (1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile.
| Compound Name | (1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
|---|---|
| PubChem CID | 118440237 |
| Molecular Formula | C18H18BrN3O3S2 |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | (1S,3S,7S)-4-(5-bromo-2-methoxyphenyl)-3,7,11-trimethyl-6,10-dioxo-8,9-dithia-5,11-diazatricyclo[5.2.2.01,5]undecane-3-carbonitrile |
| SMILES | COc1ccc(Br)cc1C1N2C(=O)[C@]3(C)SS[C@@]2(C[C@]1(C)C#N)C(=O)N3C |
| InChI | InChI=1S/C18H18BrN3O3S2/c1-16(9-20)8-18-15(24)21(3)17(2,26-27-18)14(23)22(18)13(16)11-7-10(19)5-6-12(11)25-4/h5-7,13H,8H2,1-4H3/t13?,16-,17+,18+/m1/s1 |
| InChIKey | TWPFTGDLMTVZBW-LLHIWASSSA-N |
| XLogP | 3.54 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|