C16H21F4N3O2 — CID 118440887
1-[(2R,3R,4S)-2-azido-4-butoxy-5,5,5-trifluoro-3-methoxypentan-2-yl]-2-fluorobenzene (PubChem CID 118440887) has the molecular formula C16H21F4N3O2 and a molecular weight of 363.36 g/mol. Its IUPAC name is 1-[(2R,3R,4S)-2-azido-4-butoxy-5,5,5-trifluoro-3-methoxypentan-2-yl]-2-fluorobenzene.
| Compound Name | 1-[(2R,3R,4S)-2-azido-4-butoxy-5,5,5-trifluoro-3-methoxypentan-2-yl]-2-fluorobenzene |
|---|---|
| PubChem CID | 118440887 |
| Molecular Formula | C16H21F4N3O2 |
| Molecular Weight | 363.36 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[(2R,3R,4S)-2-azido-4-butoxy-5,5,5-trifluoro-3-methoxypentan-2-yl]-2-fluorobenzene |
| SMILES | CCCCO[C@@H]([C@H](OC)[C@](C)(N=[N+]=[N-])c1ccccc1F)C(F)(F)F |
| InChI | InChI=1S/C16H21F4N3O2/c1-4-5-10-25-14(16(18,19)20)13(24-3)15(2,22-23-21)11-8-6-7-9-12(11)17/h6-9,13-14H,4-5,10H2,1-3H3/t13-,14-,15+/m0/s1 |
| InChIKey | BGPWOSDMVPXKDV-SOUVJXGZSA-N |
| XLogP | 5.11 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.36 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|