cyclopentyloxy(ethenyl)phosphinic acid

C7H13O3P — CID 118440970

IUPACcyclopentyloxy(ethenyl)phosphinic acid
SMILESC=CP(=O)(O)OC1CCCC1
InChIInChI=1S/C7H13O3P/c1-2-11(8,9)10-7-5-3-4-6-7/h2,7H,1,3-6H2,(H,8,9)
InChIKeyNDSWPRWXBMGTNO-UHFFFAOYSA-N
MW176.15 g/mol
LogP2.27
Rot. Bonds3

About cyclopentyloxy(ethenyl)phosphinic acid

cyclopentyloxy(ethenyl)phosphinic acid (PubChem CID 118440970) has the molecular formula C7H13O3P and a molecular weight of 176.15 g/mol. Its IUPAC name is cyclopentyloxy(ethenyl)phosphinic acid.

Molecular Properties

Compound Namecyclopentyloxy(ethenyl)phosphinic acid
PubChem CID118440970
Molecular FormulaC7H13O3P
Molecular Weight176.15 g/mol
Exact Mass176.06
IUPAC Namecyclopentyloxy(ethenyl)phosphinic acid
SMILESC=CP(=O)(O)OC1CCCC1
InChIInChI=1S/C7H13O3P/c1-2-11(8,9)10-7-5-3-4-6-7/h2,7H,1,3-6H2,(H,8,9)
InChIKeyNDSWPRWXBMGTNO-UHFFFAOYSA-N
XLogP2.27
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.15
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze cyclopentyloxy(ethenyl)phosphinic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of cyclopentyloxy(ethenyl)phosphinic acid?
The IUPAC name of cyclopentyloxy(ethenyl)phosphinic acid (CID 118440970) is cyclopentyloxy(ethenyl)phosphinic acid.
What is the SMILES notation for cyclopentyloxy(ethenyl)phosphinic acid?
The canonical SMILES for cyclopentyloxy(ethenyl)phosphinic acid is C=CP(=O)(O)OC1CCCC1.
What is the InChIKey of cyclopentyloxy(ethenyl)phosphinic acid?
The InChIKey is NDSWPRWXBMGTNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13O3P/c1-2-11(8,9)10-7-5-3-4-6-7/h2,7H,1,3-6H2,(H,8,9).
What are the key properties of cyclopentyloxy(ethenyl)phosphinic acid?
cyclopentyloxy(ethenyl)phosphinic acid has a molecular weight of 176.15 g/mol, XLogP of 2.27, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyloxy(ethenyl)phosphinic acid is sourced from PubChem (CID 118440970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).