C33H20F6N2O8S — CID 118441026
5-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-2-(4-methylphenoxy)benzenesulfonic acid (PubChem CID 118441026) has the molecular formula C33H20F6N2O8S and a molecular weight of 718.58 g/mol. Its IUPAC name is 5-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-2-(4-methylphenoxy)benzenesulfonic acid.
| Compound Name | 5-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-2-(4-methylphenoxy)benzenesulfonic acid |
|---|---|
| PubChem CID | 118441026 |
| Molecular Formula | C33H20F6N2O8S |
| Molecular Weight | 718.58 g/mol |
| Exact Mass | 718.08 |
| IUPAC Name | 5-[5-[1,1,1,3,3,3-hexafluoro-2-(2-methyl-1,3-dioxoisoindol-5-yl)propan-2-yl]-1,3-dioxoisoindol-2-yl]-2-(4-methylphenoxy)benzenesulfonic acid |
| SMILES | Cc1ccc(Oc2ccc(N3C(=O)c4ccc(C(c5ccc6c(c5)C(=O)N(C)C6=O)(C(F)(F)F)C(F)(F)F)cc4C3=O)cc2S(=O)(=O)O)cc1 |
| InChI | InChI=1S/C33H20F6N2O8S/c1-16-3-8-20(9-4-16)49-25-12-7-19(15-26(25)50(46,47)48)41-29(44)22-11-6-18(14-24(22)30(41)45)31(32(34,35)36,33(37,38)39)17-5-10-21-23(13-17)28(43)40(2)27(21)42/h3-15H,1-2H3,(H,46,47,48) |
| InChIKey | QWJPDCMPAGMHGV-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.58 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|