C13H14F3N3O3 — CID 118441050
(4R,5R,6R)-5-fluoro-6-[(1R)-1-fluoroethyl]-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine (PubChem CID 118441050) has the molecular formula C13H14F3N3O3 and a molecular weight of 317.27 g/mol. Its IUPAC name is (4R,5R,6R)-5-fluoro-6-[(1R)-1-fluoroethyl]-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine.
| Compound Name | (4R,5R,6R)-5-fluoro-6-[(1R)-1-fluoroethyl]-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 118441050 |
| Molecular Formula | C13H14F3N3O3 |
| Molecular Weight | 317.27 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | (4R,5R,6R)-5-fluoro-6-[(1R)-1-fluoroethyl]-4-(2-fluoro-5-nitrophenyl)-4-methyl-5,6-dihydro-1,3-oxazin-2-amine |
| SMILES | C[C@@H](F)[C@H]1OC(N)=N[C@](C)(c2cc([N+](=O)[O-])ccc2F)[C@H]1F |
| InChI | InChI=1S/C13H14F3N3O3/c1-6(14)10-11(16)13(2,18-12(17)22-10)8-5-7(19(20)21)3-4-9(8)15/h3-6,10-11H,1-2H3,(H2,17,18)/t6-,10-,11+,13-/m1/s1 |
| InChIKey | NZCYMHACCURZLS-GOGQMOAUSA-N |
| XLogP | 2.36 |
| TPSA | 90.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|