C13H12N4O4 — CID 118441402
6-(1-methyl-2,6-dioxopiperidin-3-yl)-8H-pyrido[3,4-b]pyrazine-5,7-dione (PubChem CID 118441402) has the molecular formula C13H12N4O4 and a molecular weight of 288.26 g/mol. Its IUPAC name is 6-(1-methyl-2,6-dioxopiperidin-3-yl)-8H-pyrido[3,4-b]pyrazine-5,7-dione.
| Compound Name | 6-(1-methyl-2,6-dioxopiperidin-3-yl)-8H-pyrido[3,4-b]pyrazine-5,7-dione |
|---|---|
| PubChem CID | 118441402 |
| Molecular Formula | C13H12N4O4 |
| Molecular Weight | 288.26 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 6-(1-methyl-2,6-dioxopiperidin-3-yl)-8H-pyrido[3,4-b]pyrazine-5,7-dione |
| SMILES | CN1C(=O)CCC(N2C(=O)Cc3nccnc3C2=O)C1=O |
| InChI | InChI=1S/C13H12N4O4/c1-16-9(18)3-2-8(12(16)20)17-10(19)6-7-11(13(17)21)15-5-4-14-7/h4-5,8H,2-3,6H2,1H3 |
| InChIKey | VQFCNEDTXGURGO-UHFFFAOYSA-N |
| XLogP | -0.85 |
| TPSA | 100.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.26 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|