About 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone
1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone (PubChem CID 118441490) has the molecular formula C8H6BrN3O2
and a molecular weight of 256.06 g/mol. Its IUPAC name is 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone.
Molecular Properties
| Compound Name | 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone |
| PubChem CID | 118441490 |
| Molecular Formula | C8H6BrN3O2 |
| Molecular Weight | 256.06 g/mol |
| Exact Mass | 254.96 |
| IUPAC Name | 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone |
| SMILES | O=C(CO)c1cn2c(Br)cnc2cn1 |
| InChI | InChI=1S/C8H6BrN3O2/c9-7-1-11-8-2-10-5(3-12(7)8)6(14)4-13/h1-3,13H,4H2 |
| InChIKey | OEUVINJPZLXTDV-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 67.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.06 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone?
The IUPAC name of 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone (CID 118441490) is 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone.
What is the SMILES notation for 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone?
The canonical SMILES for 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone is O=C(CO)c1cn2c(Br)cnc2cn1.
What is the InChIKey of 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone?
The InChIKey is OEUVINJPZLXTDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6BrN3O2/c9-7-1-11-8-2-10-5(3-12(7)8)6(14)4-13/h1-3,13H,4H2.
What are the key properties of 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone?
1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone has a molecular weight of 256.06 g/mol, XLogP of 0.67, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-bromoimidazo[1,2-a]pyrazin-6-yl)-2-hydroxyethanone is sourced from PubChem (CID 118441490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).