C17H21F3N6O6 — CID 118441771
[(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethoxy)benzoate (PubChem CID 118441771) has the molecular formula C17H21F3N6O6 and a molecular weight of 462.39 g/mol. Its IUPAC name is [(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethoxy)benzoate.
| Compound Name | [(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethoxy)benzoate |
|---|---|
| PubChem CID | 118441771 |
| Molecular Formula | C17H21F3N6O6 |
| Molecular Weight | 462.39 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | [(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethoxy)benzoate |
| SMILES | NC1=N[C@@H](CO)[C@@H]2N[C@H](N)N[C@]23N1C[C@H](OC(=O)c1ccc(OC(F)(F)F)cc1)C3(O)O |
| InChI | InChI=1S/C17H21F3N6O6/c18-17(19,20)32-8-3-1-7(2-4-8)12(28)31-10-5-26-14(22)23-9(6-27)11-15(26,16(10,29)30)25-13(21)24-11/h1-4,9-11,13,24-25,27,29-30H,5-6,21H2,(H2,22,23)/t9-,10-,11-,13-,15-/m0/s1 |
| InChIKey | BERBEQHITGMHEH-SFUXALCOSA-N |
| XLogP | -2.70 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.39 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|