C18H20F3N7O6 — CID 118441788
[(4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate (PubChem CID 118441788) has the molecular formula C18H20F3N7O6 and a molecular weight of 487.40 g/mol. Its IUPAC name is [(4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118441788 |
| Molecular Formula | C18H20F3N7O6 |
| Molecular Weight | 487.40 g/mol |
| Exact Mass | 487.14 |
| IUPAC Name | [(4R,9S,10aS)-2,6-diamino-4-(carbamoyloxymethyl)-10,10-dihydroxy-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate |
| SMILES | NC(=O)OC[C@@H]1N=C(N)N2C[C@H](OC(=O)c3ccc(C(F)(F)F)cc3)C(O)(O)[C@@]23NC(N)=NC13 |
| InChI | InChI=1S/C18H20F3N7O6/c19-18(20,21)8-3-1-7(2-4-8)12(29)34-10-5-28-14(23)25-9(6-33-15(24)30)11-16(28,17(10,31)32)27-13(22)26-11/h1-4,9-11,31-32H,5-6H2,(H2,23,25)(H2,24,30)(H3,22,26,27)/t9-,10-,11?,16-/m0/s1 |
| InChIKey | ASYFYJSLTNBFQG-ZXXYZJNTSA-N |
| XLogP | -2.00 |
| TPSA | 211.11 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.40 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|