C16H18ClFN6O5 — CID 118441859
[(4R,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-chloro-4-fluorobenzoate (PubChem CID 118441859) has the molecular formula C16H18ClFN6O5 and a molecular weight of 428.81 g/mol. Its IUPAC name is [(4R,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-chloro-4-fluorobenzoate.
| Compound Name | [(4R,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-chloro-4-fluorobenzoate |
|---|---|
| PubChem CID | 118441859 |
| Molecular Formula | C16H18ClFN6O5 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [(4R,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-chloro-4-fluorobenzoate |
| SMILES | NC1=NC2[C@H](CO)N=C(N)N3C[C@H](OC(=O)c4ccc(F)cc4Cl)C(O)(O)C23N1 |
| InChI | InChI=1S/C16H18ClFN6O5/c17-8-3-6(18)1-2-7(8)12(26)29-10-4-24-14(20)21-9(5-25)11-15(24,16(10,27)28)23-13(19)22-11/h1-3,9-11,25,27-28H,4-5H2,(H2,20,21)(H3,19,22,23)/t9-,10-,11?,15?/m0/s1 |
| InChIKey | HLJJNNPHQAQLII-ZNPWSYNXSA-N |
| XLogP | -2.33 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|