C17H19F3N6O4 — CID 118442002
[(4R,9S,10R,10aS)-2,6-diamino-10-hydroxy-4-(hydroxymethyl)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate (PubChem CID 118442002) has the molecular formula C17H19F3N6O4 and a molecular weight of 428.37 g/mol. Its IUPAC name is [(4R,9S,10R,10aS)-2,6-diamino-10-hydroxy-4-(hydroxymethyl)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(4R,9S,10R,10aS)-2,6-diamino-10-hydroxy-4-(hydroxymethyl)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118442002 |
| Molecular Formula | C17H19F3N6O4 |
| Molecular Weight | 428.37 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | [(4R,9S,10R,10aS)-2,6-diamino-10-hydroxy-4-(hydroxymethyl)-1,3a,4,8,9,10-hexahydropyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate |
| SMILES | NC1=NC2[C@H](CO)N=C(N)N3C[C@H](OC(=O)c4ccc(C(F)(F)F)cc4)[C@H](O)[C@]23N1 |
| InChI | InChI=1S/C17H19F3N6O4/c18-17(19,20)8-3-1-7(2-4-8)13(29)30-10-5-26-15(22)23-9(6-27)11-16(26,12(10)28)25-14(21)24-11/h1-4,9-12,27-28H,5-6H2,(H2,22,23)(H3,21,24,25)/t9-,10-,11?,12-,16-/m0/s1 |
| InChIKey | YUNQTPLFDGBIKV-KQKGWSIVSA-N |
| XLogP | -1.42 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.37 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |