C25H40O10 — CID 118442003
3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]-4,10,14,20,22,23-hexaoxatricyclo[17.2.1.12,5]tricosane-9,15-dione (PubChem CID 118442003) has the molecular formula C25H40O10 and a molecular weight of 500.59 g/mol. Its IUPAC name is 3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]-4,10,14,20,22,23-hexaoxatricyclo[17.2.1.12,5]tricosane-9,15-dione.
| Compound Name | 3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]-4,10,14,20,22,23-hexaoxatricyclo[17.2.1.12,5]tricosane-9,15-dione |
|---|---|
| PubChem CID | 118442003 |
| Molecular Formula | C25H40O10 |
| Molecular Weight | 500.59 g/mol |
| Exact Mass | 500.26 |
| IUPAC Name | 3-[2-methyl-2-(2-methylpropyl)-1,3-dioxolan-4-yl]-4,10,14,20,22,23-hexaoxatricyclo[17.2.1.12,5]tricosane-9,15-dione |
| SMILES | CC(C)CC1(C)OCC(C2OC3CCCC(=O)OCCCOC(=O)CCCC4OCC(O4)C2O3)O1 |
| InChI | InChI=1S/C25H40O10/c1-16(2)13-25(3)31-15-18(35-25)24-23-17-14-30-21(32-17)9-4-7-19(26)28-11-6-12-29-20(27)8-5-10-22(33-23)34-24/h16-18,21-24H,4-15H2,1-3H3 |
| InChIKey | SKUQNJGISNXHNN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 107.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.59 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |