C18H21F3N6O5 — CID 118442183
[(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate (PubChem CID 118442183) has the molecular formula C18H21F3N6O5 and a molecular weight of 458.40 g/mol. Its IUPAC name is [(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118442183 |
| Molecular Formula | C18H21F3N6O5 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [(3aS,4R,8S,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2-(trifluoromethyl)benzoate |
| SMILES | C[C@H]1[C@H](OC(=O)c2ccccc2C(F)(F)F)C(O)(O)[C@]23NC(N)=N[C@H]2[C@H](CO)N=C(N)N13 |
| InChI | InChI=1S/C18H21F3N6O5/c1-7-12(32-13(29)8-4-2-3-5-9(8)18(19,20)21)17(30,31)16-11(25-14(22)26-16)10(6-28)24-15(23)27(7)16/h2-5,7,10-12,28,30-31H,6H2,1H3,(H2,23,24)(H3,22,25,26)/t7-,10-,11-,12-,16-/m0/s1 |
| InChIKey | PXKKTPHUYCKCLC-HJUPUXBDSA-N |
| XLogP | -1.71 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|