C19H20F6N6O5 — CID 118442186
[(3aS,4R,8S,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate (PubChem CID 118442186) has the molecular formula C19H20F6N6O5 and a molecular weight of 526.39 g/mol. Its IUPAC name is [(3aS,4R,8S,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate.
| Compound Name | [(3aS,4R,8S,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118442186 |
| Molecular Formula | C19H20F6N6O5 |
| Molecular Weight | 526.39 g/mol |
| Exact Mass | 526.14 |
| IUPAC Name | [(3aS,4R,8S,9S)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-8-methyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 2,5-bis(trifluoromethyl)benzoate |
| SMILES | C[C@H]1[C@H](OC(=O)c2cc(C(F)(F)F)ccc2C(F)(F)F)C(O)(O)C23NC(N)=NC2[C@H](CO)N=C(N)N13 |
| InChI | InChI=1S/C19H20F6N6O5/c1-6-12(36-13(33)8-4-7(18(20,21)22)2-3-9(8)19(23,24)25)17(34,35)16-11(29-14(26)30-16)10(5-32)28-15(27)31(6)16/h2-4,6,10-12,32,34-35H,5H2,1H3,(H2,27,28)(H3,26,29,30)/t6-,10-,11?,12-,16?/m0/s1 |
| InChIKey | ZHQLXFCWRJTGPA-PYQKWDOASA-N |
| XLogP | -0.69 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.39 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|