C21H21F3N6O5 — CID 118442233
[(4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 3-(trifluoromethyl)naphthalene-1-carboxylate (PubChem CID 118442233) has the molecular formula C21H21F3N6O5 and a molecular weight of 494.43 g/mol. Its IUPAC name is [(4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 3-(trifluoromethyl)naphthalene-1-carboxylate.
| Compound Name | [(4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 3-(trifluoromethyl)naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 118442233 |
| Molecular Formula | C21H21F3N6O5 |
| Molecular Weight | 494.43 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | [(4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 3-(trifluoromethyl)naphthalene-1-carboxylate |
| SMILES | NC1=NC2[C@H](CO)N=C(N)N3C[C@H](OC(=O)c4cc(C(F)(F)F)cc5ccccc45)C(O)(O)[C@]23N1 |
| InChI | InChI=1S/C21H21F3N6O5/c22-21(23,24)10-5-9-3-1-2-4-11(9)12(6-10)16(32)35-14-7-30-18(26)27-13(8-31)15-19(30,20(14,33)34)29-17(25)28-15/h1-6,13-15,31,33-34H,7-8H2,(H2,26,27)(H3,25,28,29)/t13-,14-,15?,19-/m0/s1 |
| InChIKey | HOBSHYIJSKECMY-PEHVMJGBSA-N |
| XLogP | -0.95 |
| TPSA | 179.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.43 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|