C22H35FO — CID 118442490
(3R,5R,8R,9R,10S,13S,14S,17R)-3-(fluoromethyl)-13-methyl-17-prop-1-en-2-yl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol (PubChem CID 118442490) has the molecular formula C22H35FO and a molecular weight of 334.52 g/mol. Its IUPAC name is (3R,5R,8R,9R,10S,13S,14S,17R)-3-(fluoromethyl)-13-methyl-17-prop-1-en-2-yl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol.
| Compound Name | (3R,5R,8R,9R,10S,13S,14S,17R)-3-(fluoromethyl)-13-methyl-17-prop-1-en-2-yl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
|---|---|
| PubChem CID | 118442490 |
| Molecular Formula | C22H35FO |
| Molecular Weight | 334.52 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | (3R,5R,8R,9R,10S,13S,14S,17R)-3-(fluoromethyl)-13-methyl-17-prop-1-en-2-yl-2,4,5,6,7,8,9,10,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| SMILES | C=C(C)[C@H]1CC[C@H]2[C@@H]3CC[C@@H]4C[C@@](O)(CF)CC[C@@H]4[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H35FO/c1-14(2)19-6-7-20-18-5-4-15-12-22(24,13-23)11-9-16(15)17(18)8-10-21(19,20)3/h15-20,24H,1,4-13H2,2-3H3/t15-,16+,17-,18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | AKUUGEJPDROJOA-IIPSAPQISA-N |
| XLogP | 5.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|