C17H32N6O7S — CID 118442676
(4R,9S)-2,6-diamino-4-(hydroxymethyl)-9-[hydroxy-(4-methylsulfonylcyclohexyl)methoxy]-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol (PubChem CID 118442676) has the molecular formula C17H32N6O7S and a molecular weight of 464.55 g/mol. Its IUPAC name is (4R,9S)-2,6-diamino-4-(hydroxymethyl)-9-[hydroxy-(4-methylsulfonylcyclohexyl)methoxy]-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol.
| Compound Name | (4R,9S)-2,6-diamino-4-(hydroxymethyl)-9-[hydroxy-(4-methylsulfonylcyclohexyl)methoxy]-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
|---|---|
| PubChem CID | 118442676 |
| Molecular Formula | C17H32N6O7S |
| Molecular Weight | 464.55 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (4R,9S)-2,6-diamino-4-(hydroxymethyl)-9-[hydroxy-(4-methylsulfonylcyclohexyl)methoxy]-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purine-10,10-diol |
| SMILES | CS(=O)(=O)C1CCC(C(O)O[C@H]2CN3C(N)=N[C@@H](CO)C4NC(N)NC43C2(O)O)CC1 |
| InChI | InChI=1S/C17H32N6O7S/c1-31(28,29)9-4-2-8(3-5-9)13(25)30-11-6-23-15(19)20-10(7-24)12-16(23,17(11,26)27)22-14(18)21-12/h8-14,21-22,24-27H,2-7,18H2,1H3,(H2,19,20)/t8?,9?,10-,11-,12?,13?,14?,16?/m0/s1 |
| InChIKey | YMAHPZJAEBCSFU-FMZHKRSUSA-N |
| XLogP | -4.52 |
| TPSA | 215.99 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.55 |
| LogP ≤ 5 | -4.52 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|