C25H27F3N6O4 — CID 118442949
[(4R,8S,9S,10R,10aS)-2,6-diamino-10-ethyl-10-hydroxy-4-(hydroxymethyl)-8-phenyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate (PubChem CID 118442949) has the molecular formula C25H27F3N6O4 and a molecular weight of 532.52 g/mol. Its IUPAC name is [(4R,8S,9S,10R,10aS)-2,6-diamino-10-ethyl-10-hydroxy-4-(hydroxymethyl)-8-phenyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate.
| Compound Name | [(4R,8S,9S,10R,10aS)-2,6-diamino-10-ethyl-10-hydroxy-4-(hydroxymethyl)-8-phenyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 118442949 |
| Molecular Formula | C25H27F3N6O4 |
| Molecular Weight | 532.52 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | [(4R,8S,9S,10R,10aS)-2,6-diamino-10-ethyl-10-hydroxy-4-(hydroxymethyl)-8-phenyl-3a,4,8,9-tetrahydro-1H-pyrrolo[1,2-c]purin-9-yl] 4-(trifluoromethyl)benzoate |
| SMILES | CC[C@]1(O)[C@@H](OC(=O)c2ccc(C(F)(F)F)cc2)[C@H](c2ccccc2)N2C(N)=N[C@@H](CO)C3N=C(N)N[C@@]321 |
| InChI | InChI=1S/C25H27F3N6O4/c1-2-23(37)19(38-20(36)14-8-10-15(11-9-14)25(26,27)28)17(13-6-4-3-5-7-13)34-22(30)31-16(12-35)18-24(23,34)33-21(29)32-18/h3-11,16-19,35,37H,2,12H2,1H3,(H2,30,31)(H3,29,32,33)/t16-,17-,18?,19-,23-,24-/m0/s1 |
| InChIKey | GEOCYCTUXKMROX-WWSQPFPHSA-N |
| XLogP | 1.10 |
| TPSA | 158.79 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.52 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |