C18H25F3N6O6 — CID 118442971
[(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] (2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienoate (PubChem CID 118442971) has the molecular formula C18H25F3N6O6 and a molecular weight of 478.43 g/mol. Its IUPAC name is [(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] (2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienoate.
| Compound Name | [(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] (2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 118442971 |
| Molecular Formula | C18H25F3N6O6 |
| Molecular Weight | 478.43 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | [(2S,3aS,4R,9S,10aS)-2,6-diamino-10,10-dihydroxy-4-(hydroxymethyl)-2,3,3a,4,8,9-hexahydro-1H-pyrrolo[1,2-c]purin-9-yl] (2E)-2-[(Z)-3-(trifluoromethoxy)prop-1-enyl]penta-2,4-dienoate |
| SMILES | C=C/C=C(\C=C/COC(F)(F)F)C(=O)O[C@H]1CN2C(N)=N[C@@H](CO)[C@@H]3N[C@H](N)N[C@@]32C1(O)O |
| InChI | InChI=1S/C18H25F3N6O6/c1-2-4-9(5-3-6-32-18(19,20)21)13(29)33-11-7-27-15(23)24-10(8-28)12-16(27,17(11,30)31)26-14(22)25-12/h2-5,10-12,14,25-26,28,30-31H,1,6-8,22H2,(H2,23,24)/b5-3-,9-4+/t10-,11-,12-,14-,16-/m0/s1 |
| InChIKey | KTIIOLYPPVIVMJ-OTOUPOMUSA-N |
| XLogP | -2.71 |
| TPSA | 187.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.43 |
| LogP ≤ 5 | -2.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|