C15H12ClF3N4O — CID 118443060
4-chloro-2-[[6-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]pyrazolo[4,3-c]pyridine (PubChem CID 118443060) has the molecular formula C15H12ClF3N4O and a molecular weight of 356.74 g/mol. Its IUPAC name is 4-chloro-2-[[6-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]pyrazolo[4,3-c]pyridine.
| Compound Name | 4-chloro-2-[[6-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]pyrazolo[4,3-c]pyridine |
|---|---|
| PubChem CID | 118443060 |
| Molecular Formula | C15H12ClF3N4O |
| Molecular Weight | 356.74 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | 4-chloro-2-[[6-methyl-5-(2,2,2-trifluoroethoxy)-2-pyridinyl]methyl]pyrazolo[4,3-c]pyridine |
| SMILES | Cc1nc(Cn2cc3c(Cl)nccc3n2)ccc1OCC(F)(F)F |
| InChI | InChI=1S/C15H12ClF3N4O/c1-9-13(24-8-15(17,18)19)3-2-10(21-9)6-23-7-11-12(22-23)4-5-20-14(11)16/h2-5,7H,6,8H2,1H3 |
| InChIKey | ZAIRNVCBFBNEQR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.74 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|