C24H19F3N4O3 — CID 118443069
phenyl 2-[[5-cyclopropyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxylate (PubChem CID 118443069) has the molecular formula C24H19F3N4O3 and a molecular weight of 468.44 g/mol. Its IUPAC name is phenyl 2-[[5-cyclopropyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxylate.
| Compound Name | phenyl 2-[[5-cyclopropyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxylate |
|---|---|
| PubChem CID | 118443069 |
| Molecular Formula | C24H19F3N4O3 |
| Molecular Weight | 468.44 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | phenyl 2-[[5-cyclopropyl-6-(2,2,2-trifluoroethoxy)-3-pyridinyl]methyl]pyrazolo[4,3-c]pyridine-4-carboxylate |
| SMILES | O=C(Oc1ccccc1)c1nccc2nn(Cc3cnc(OCC(F)(F)F)c(C4CC4)c3)cc12 |
| InChI | InChI=1S/C24H19F3N4O3/c25-24(26,27)14-33-22-18(16-6-7-16)10-15(11-29-22)12-31-13-19-20(30-31)8-9-28-21(19)23(32)34-17-4-2-1-3-5-17/h1-5,8-11,13,16H,6-7,12,14H2 |
| InChIKey | BDGLQBUGRBARQO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.44 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|