C15H17N5O4S — CID 118443393
(4Z)-4-methoxyimino-5-methyl-N-(2-methyl-1,2,4-triazol-3-yl)-1,1-dioxo-2,3-dihydrothiochromene-6-carboxamide (PubChem CID 118443393) has the molecular formula C15H17N5O4S and a molecular weight of 363.40 g/mol. Its IUPAC name is (4Z)-4-methoxyimino-5-methyl-N-(2-methyl-1,2,4-triazol-3-yl)-1,1-dioxo-2,3-dihydrothiochromene-6-carboxamide.
| Compound Name | (4Z)-4-methoxyimino-5-methyl-N-(2-methyl-1,2,4-triazol-3-yl)-1,1-dioxo-2,3-dihydrothiochromene-6-carboxamide |
|---|---|
| PubChem CID | 118443393 |
| Molecular Formula | C15H17N5O4S |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.10 |
| IUPAC Name | (4Z)-4-methoxyimino-5-methyl-N-(2-methyl-1,2,4-triazol-3-yl)-1,1-dioxo-2,3-dihydrothiochromene-6-carboxamide |
| SMILES | CO/N=C1/CCS(=O)(=O)c2ccc(C(=O)Nc3ncnn3C)c(C)c21 |
| InChI | InChI=1S/C15H17N5O4S/c1-9-10(14(21)18-15-16-8-17-20(15)2)4-5-12-13(9)11(19-24-3)6-7-25(12,22)23/h4-5,8H,6-7H2,1-3H3,(H,16,17,18,21)/b19-11- |
| InChIKey | WWBPHUFSWJJJQD-ODLFYWEKSA-N |
| XLogP | 0.90 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|