C20H30O3 — CID 11844356
(1S,4E,8S,10S,13E,15R,18R)-4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-diene (PubChem CID 11844356) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S,4E,8S,10S,13E,15R,18R)-4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-diene.
| Compound Name | (1S,4E,8S,10S,13E,15R,18R)-4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-diene |
|---|---|
| PubChem CID | 11844356 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S,4E,8S,10S,13E,15R,18R)-4,8,13,18-tetramethyl-9,16,19-trioxatetracyclo[13.4.0.01,18.08,10]nonadeca-4,13-diene |
| SMILES | C/C1=C\[C@H]2OC[C@@]3(C)O[C@@]23CC/C(C)=C/CC[C@]2(C)O[C@H]2CC1 |
| InChI | InChI=1S/C20H30O3/c1-14-6-5-10-18(3)16(22-18)8-7-15(2)12-17-20(11-9-14)19(4,23-20)13-21-17/h6,12,16-17H,5,7-11,13H2,1-4H3/b14-6+,15-12+/t16-,17+,18-,19+,20-/m0/s1 |
| InChIKey | SINIBGHULULTLM-LWLWWNTNSA-N |
| XLogP | 4.32 |
| TPSA | 34.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|