C18H18F3N5O2 — CID 118443718
3-methyl-1-(tetrazol-1-yl)-2-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]butan-2-ol (PubChem CID 118443718) has the molecular formula C18H18F3N5O2 and a molecular weight of 393.37 g/mol. Its IUPAC name is 3-methyl-1-(tetrazol-1-yl)-2-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]butan-2-ol.
| Compound Name | 3-methyl-1-(tetrazol-1-yl)-2-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]butan-2-ol |
|---|---|
| PubChem CID | 118443718 |
| Molecular Formula | C18H18F3N5O2 |
| Molecular Weight | 393.37 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 3-methyl-1-(tetrazol-1-yl)-2-[5-[4-(trifluoromethoxy)phenyl]-2-pyridinyl]butan-2-ol |
| SMILES | CC(C)C(O)(Cn1cnnn1)c1ccc(-c2ccc(OC(F)(F)F)cc2)cn1 |
| InChI | InChI=1S/C18H18F3N5O2/c1-12(2)17(27,10-26-11-23-24-25-26)16-8-5-14(9-22-16)13-3-6-15(7-4-13)28-18(19,20)21/h3-9,11-12,27H,10H2,1-2H3 |
| InChIKey | XJMVJEWVPCDYIG-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.37 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |