C24H25N3O3 — CID 118443962
2-(2,5-dimethylpyrrol-1-yl)-4-(4-phenylpiperazine-1-carbonyl)benzoic acid (PubChem CID 118443962) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 2-(2,5-dimethylpyrrol-1-yl)-4-(4-phenylpiperazine-1-carbonyl)benzoic acid.
| Compound Name | 2-(2,5-dimethylpyrrol-1-yl)-4-(4-phenylpiperazine-1-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 118443962 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 2-(2,5-dimethylpyrrol-1-yl)-4-(4-phenylpiperazine-1-carbonyl)benzoic acid |
| SMILES | Cc1ccc(C)n1-c1cc(C(=O)N2CCN(c3ccccc3)CC2)ccc1C(=O)O |
| InChI | InChI=1S/C24H25N3O3/c1-17-8-9-18(2)27(17)22-16-19(10-11-21(22)24(29)30)23(28)26-14-12-25(13-15-26)20-6-4-3-5-7-20/h3-11,16H,12-15H2,1-2H3,(H,29,30) |
| InChIKey | NIWZAIUMGKSTJZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|