About [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate
[4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate (PubChem CID 118444005) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate.
Molecular Properties
| Compound Name | [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate |
| PubChem CID | 118444005 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate |
| SMILES | O=CC(=O)OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C10H16O4/c11-5-8-1-3-9(4-2-8)7-14-10(13)6-12/h6,8-9,11H,1-5,7H2 |
| InChIKey | NJPUOHJLMPIUHX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate?
The IUPAC name of [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate (CID 118444005) is [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate.
What is the SMILES notation for [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate?
The canonical SMILES for [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate is O=CC(=O)OCC1CCC(CO)CC1.
What is the InChIKey of [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate?
The InChIKey is NJPUOHJLMPIUHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c11-5-8-1-3-9(4-2-8)7-14-10(13)6-12/h6,8-9,11H,1-5,7H2.
What are the key properties of [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate?
[4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate has a molecular weight of 200.23 g/mol, XLogP of 0.53, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(hydroxymethyl)cyclohexyl]methyl 2-oxoacetate is sourced from PubChem (CID 118444005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).