About tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate
tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate (PubChem CID 11844458) has the molecular formula C14H26O3S
and a molecular weight of 274.43 g/mol. Its IUPAC name is tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate.
Molecular Properties
| Compound Name | tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate |
| PubChem CID | 11844458 |
| Molecular Formula | C14H26O3S |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate |
| SMILES | CCCSC[C@@H]1CC[C@H](CC(=O)OC(C)(C)C)O1 |
| InChI | InChI=1S/C14H26O3S/c1-5-8-18-10-12-7-6-11(16-12)9-13(15)17-14(2,3)4/h11-12H,5-10H2,1-4H3/t11-,12+/m1/s1 |
| InChIKey | UBJVEFFJJWQVQY-NEPJUHHUSA-N |
| XLogP | 3.41 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate?
The IUPAC name of tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate (CID 11844458) is tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate.
What is the SMILES notation for tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate?
The canonical SMILES for tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate is CCCSC[C@@H]1CC[C@H](CC(=O)OC(C)(C)C)O1.
What is the InChIKey of tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate?
The InChIKey is UBJVEFFJJWQVQY-NEPJUHHUSA-N. The full InChI is InChI=1S/C14H26O3S/c1-5-8-18-10-12-7-6-11(16-12)9-13(15)17-14(2,3)4/h11-12H,5-10H2,1-4H3/t11-,12+/m1/s1.
What are the key properties of tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate?
tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate has a molecular weight of 274.43 g/mol, XLogP of 3.41, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2-[(2R,5S)-5-(propylsulfanylmethyl)oxolan-2-yl]acetate is sourced from PubChem (CID 11844458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).