About 2,2,2-trichloroethyl 2-methoxyhex-5-enoate
2,2,2-trichloroethyl 2-methoxyhex-5-enoate (PubChem CID 118444828) has the molecular formula C9H13Cl3O3
and a molecular weight of 275.56 g/mol. Its IUPAC name is 2,2,2-trichloroethyl 2-methoxyhex-5-enoate.
Molecular Properties
| Compound Name | 2,2,2-trichloroethyl 2-methoxyhex-5-enoate |
| PubChem CID | 118444828 |
| Molecular Formula | C9H13Cl3O3 |
| Molecular Weight | 275.56 g/mol |
| Exact Mass | 273.99 |
| IUPAC Name | 2,2,2-trichloroethyl 2-methoxyhex-5-enoate |
| SMILES | C=CCCC(OC)C(=O)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C9H13Cl3O3/c1-3-4-5-7(14-2)8(13)15-6-9(10,11)12/h3,7H,1,4-6H2,2H3 |
| InChIKey | VCCZZTFXYRQNGO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,2,2-trichloroethyl 2-methoxyhex-5-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2,2-trichloroethyl 2-methoxyhex-5-enoate?
The IUPAC name of 2,2,2-trichloroethyl 2-methoxyhex-5-enoate (CID 118444828) is 2,2,2-trichloroethyl 2-methoxyhex-5-enoate.
What is the SMILES notation for 2,2,2-trichloroethyl 2-methoxyhex-5-enoate?
The canonical SMILES for 2,2,2-trichloroethyl 2-methoxyhex-5-enoate is C=CCCC(OC)C(=O)OCC(Cl)(Cl)Cl.
What is the InChIKey of 2,2,2-trichloroethyl 2-methoxyhex-5-enoate?
The InChIKey is VCCZZTFXYRQNGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl3O3/c1-3-4-5-7(14-2)8(13)15-6-9(10,11)12/h3,7H,1,4-6H2,2H3.
What are the key properties of 2,2,2-trichloroethyl 2-methoxyhex-5-enoate?
2,2,2-trichloroethyl 2-methoxyhex-5-enoate has a molecular weight of 275.56 g/mol, XLogP of 2.88, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2,2-trichloroethyl 2-methoxyhex-5-enoate is sourced from PubChem (CID 118444828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).