C32H35FN6O4 — CID 11844487
(2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate (PubChem CID 11844487) has the molecular formula C32H35FN6O4 and a molecular weight of 586.67 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 11844487 |
| Molecular Formula | C32H35FN6O4 |
| Molecular Weight | 586.67 g/mol |
| Exact Mass | 586.27 |
| IUPAC Name | (2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[3-fluoro-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(N(C(=O)Oc2c(C)cccc2C)c2ccnc(Nc3ccc(N4CCN(C)CC4)c(F)c3)n2)c(OC)c1 |
| InChI | InChI=1S/C32H35FN6O4/c1-21-7-6-8-22(2)30(21)43-32(40)39(27-12-10-24(41-4)20-28(27)42-5)29-13-14-34-31(36-29)35-23-9-11-26(25(33)19-23)38-17-15-37(3)16-18-38/h6-14,19-20H,15-18H2,1-5H3,(H,34,35,36) |
| InChIKey | OWVLKCRXPYZKDI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.67 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|