C32H37N5O5 — CID 11844488
(2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl]carbamate (PubChem CID 11844488) has the molecular formula C32H37N5O5 and a molecular weight of 571.68 g/mol. Its IUPAC name is (2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl]carbamate.
| Compound Name | (2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl]carbamate |
|---|---|
| PubChem CID | 11844488 |
| Molecular Formula | C32H37N5O5 |
| Molecular Weight | 571.68 g/mol |
| Exact Mass | 571.28 |
| IUPAC Name | (2,6-dimethylphenyl) N-(2,4-dimethoxyphenyl)-N-[2-[4-[3-(dimethylamino)propoxy]anilino]pyrimidin-4-yl]carbamate |
| SMILES | COc1ccc(N(C(=O)Oc2c(C)cccc2C)c2ccnc(Nc3ccc(OCCCN(C)C)cc3)n2)c(OC)c1 |
| InChI | InChI=1S/C32H37N5O5/c1-22-9-7-10-23(2)30(22)42-32(38)37(27-16-15-26(39-5)21-28(27)40-6)29-17-18-33-31(35-29)34-24-11-13-25(14-12-24)41-20-8-19-36(3)4/h7,9-18,21H,8,19-20H2,1-6H3,(H,33,34,35) |
| InChIKey | JBUBKVHDFJCRSZ-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 98.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.68 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|