C20H30O3 — CID 11844490
(1R,2E,6S,8S,11E,14S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-14-ol (PubChem CID 11844490) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1R,2E,6S,8S,11E,14S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-14-ol.
| Compound Name | (1R,2E,6S,8S,11E,14S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-14-ol |
|---|---|
| PubChem CID | 11844490 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1R,2E,6S,8S,11E,14S)-3,8,12,16-tetramethyl-7,18-dioxatricyclo[13.3.0.06,8]octadeca-2,11,15-trien-14-ol |
| SMILES | CC1=C2[C@@H](O)C/C(C)=C/CC[C@]3(C)O[C@H]3CC/C(C)=C/[C@H]2OC1 |
| InChI | InChI=1S/C20H30O3/c1-13-6-5-9-20(4)18(23-20)8-7-14(2)11-17-19(16(21)10-13)15(3)12-22-17/h6,11,16-18,21H,5,7-10,12H2,1-4H3/b13-6+,14-11+/t16-,17+,18-,20-/m0/s1 |
| InChIKey | ZLZPIHHAJYNCAU-NZBKKJSSSA-N |
| XLogP | 4.08 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|