C38H22N4O2S2 — CID 118445141
2,8-bis[5-(4-phenylphenyl)furan-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene (PubChem CID 118445141) has the molecular formula C38H22N4O2S2 and a molecular weight of 630.75 g/mol. Its IUPAC name is 2,8-bis[5-(4-phenylphenyl)furan-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene.
| Compound Name | 2,8-bis[5-(4-phenylphenyl)furan-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
|---|---|
| PubChem CID | 118445141 |
| Molecular Formula | C38H22N4O2S2 |
| Molecular Weight | 630.75 g/mol |
| Exact Mass | 630.12 |
| IUPAC Name | 2,8-bis[5-(4-phenylphenyl)furan-2-yl]-5λ4,11-dithia-4,6,10,12-tetrazatricyclo[7.3.0.03,7]dodeca-1(12),2,4,5,7,9-hexaene |
| SMILES | c1ccc(-c2ccc(-c3ccc(-c4c5c(c(-c6ccc(-c7ccc(-c8ccccc8)cc7)o6)c6nsnc46)N=S=N5)o3)cc2)cc1 |
| InChI | InChI=1S/C38H22N4O2S2/c1-3-7-23(8-4-1)25-11-15-27(16-12-25)29-19-21-31(43-29)33-35-37(41-45-39-35)34(38-36(33)40-46-42-38)32-22-20-30(44-32)28-17-13-26(14-18-28)24-9-5-2-6-10-24/h1-22H |
| InChIKey | OFVRELIJGRNKIM-UHFFFAOYSA-N |
| XLogP | 11.61 |
| TPSA | 76.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.75 |
| LogP ≤ 5 | 11.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |