About (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane
(6R)-4-methyl-6-propan-2-yl-1,4-oxazepane (PubChem CID 118445298) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane.
Molecular Properties
| Compound Name | (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane |
| PubChem CID | 118445298 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane |
| SMILES | CC(C)[C@H]1COCCN(C)C1 |
| InChI | InChI=1S/C9H19NO/c1-8(2)9-6-10(3)4-5-11-7-9/h8-9H,4-7H2,1-3H3/t9-/m1/s1 |
| InChIKey | IPOBZNCNMPVUHO-SECBINFHSA-N |
| XLogP | 1.22 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane?
The IUPAC name of (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane (CID 118445298) is (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane.
What is the SMILES notation for (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane?
The canonical SMILES for (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane is CC(C)[C@H]1COCCN(C)C1.
What is the InChIKey of (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane?
The InChIKey is IPOBZNCNMPVUHO-SECBINFHSA-N. The full InChI is InChI=1S/C9H19NO/c1-8(2)9-6-10(3)4-5-11-7-9/h8-9H,4-7H2,1-3H3/t9-/m1/s1.
What are the key properties of (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane?
(6R)-4-methyl-6-propan-2-yl-1,4-oxazepane has a molecular weight of 157.26 g/mol, XLogP of 1.22, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-4-methyl-6-propan-2-yl-1,4-oxazepane is sourced from PubChem (CID 118445298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).