C72H46N6O2P2 — CID 118445510
2,9-bis[3-diphenylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline (PubChem CID 118445510) has the molecular formula C72H46N6O2P2 and a molecular weight of 1089.15 g/mol. Its IUPAC name is 2,9-bis[3-diphenylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline.
| Compound Name | 2,9-bis[3-diphenylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 118445510 |
| Molecular Formula | C72H46N6O2P2 |
| Molecular Weight | 1089.15 g/mol |
| Exact Mass | 1088.32 |
| IUPAC Name | 2,9-bis[3-diphenylphosphoryl-5-(1,10-phenanthrolin-2-yl)phenyl]-1,10-phenanthroline |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1cc(-c2ccc3ccc4cccnc4c3n2)cc(-c2ccc3ccc4ccc(-c5cc(-c6ccc7ccc8cccnc8c7n6)cc(P(=O)(c6ccccc6)c6ccccc6)c5)nc4c3n2)c1 |
| InChI | InChI=1S/C72H46N6O2P2/c79-81(57-17-5-1-6-18-57,58-19-7-2-8-20-58)61-43-53(63-35-31-49-27-25-47-15-13-39-73-67(47)69(49)75-63)41-55(45-61)65-37-33-51-29-30-52-34-38-66(78-72(52)71(51)77-65)56-42-54(64-36-32-50-28-26-48-16-14-40-74-68(48)70(50)76-64)44-62(46-56)82(80,59-21-9-3-10-22-59)60-23-11-4-12-24-60/h1-46H |
| InChIKey | WMZHIZSVPVXLGN-UHFFFAOYSA-N |
| XLogP | 14.92 |
| TPSA | 111.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1089.15 |
| LogP ≤ 5 | 14.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|