C17H22N2O2 — CID 118445642
3,5-dimethyl-4-[2-methyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxidopyridazin-1-ium (PubChem CID 118445642) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is 3,5-dimethyl-4-[2-methyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxidopyridazin-1-ium.
| Compound Name | 3,5-dimethyl-4-[2-methyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxidopyridazin-1-ium |
|---|---|
| PubChem CID | 118445642 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 3,5-dimethyl-4-[2-methyl-4-[(2-methylpropan-2-yl)oxy]phenyl]-1-oxidopyridazin-1-ium |
| SMILES | Cc1cc(OC(C)(C)C)ccc1-c1c(C)c[n+]([O-])nc1C |
| InChI | InChI=1S/C17H22N2O2/c1-11-9-14(21-17(4,5)6)7-8-15(11)16-12(2)10-19(20)18-13(16)3/h7-10H,1-6H3 |
| InChIKey | ARWFKZVFDDWSMB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|