C20H23N2O6P — CID 118445853
3-benzoyl-5-methyl-1-[(1S,3R)-3-(1-phosphorosooxyethoxy)cyclohexyl]pyrimidine-2,4-dione (PubChem CID 118445853) has the molecular formula C20H23N2O6P and a molecular weight of 418.39 g/mol. Its IUPAC name is 3-benzoyl-5-methyl-1-[(1S,3R)-3-(1-phosphorosooxyethoxy)cyclohexyl]pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-5-methyl-1-[(1S,3R)-3-(1-phosphorosooxyethoxy)cyclohexyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118445853 |
| Molecular Formula | C20H23N2O6P |
| Molecular Weight | 418.39 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | 3-benzoyl-5-methyl-1-[(1S,3R)-3-(1-phosphorosooxyethoxy)cyclohexyl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CCC[C@@H](OC(C)OP=O)C2)c(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C20H23N2O6P/c1-13-12-21(16-9-6-10-17(11-16)27-14(2)28-29-26)20(25)22(18(13)23)19(24)15-7-4-3-5-8-15/h3-5,7-8,12,14,16-17H,6,9-11H2,1-2H3/t14?,16-,17+/m0/s1 |
| InChIKey | AWHYHGSRPPLDPL-MWSTZMHHSA-N |
| XLogP | 3.08 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|