C21H11F3N2O3 — CID 11844609
9-hydroxy-4-[2-(trifluoromethyl)phenyl]-6H-pyrrolo[3,4-c]carbazole-1,3-dione (PubChem CID 11844609) has the molecular formula C21H11F3N2O3 and a molecular weight of 396.32 g/mol. Its IUPAC name is 9-hydroxy-4-[2-(trifluoromethyl)phenyl]-6H-pyrrolo[3,4-c]carbazole-1,3-dione.
| Compound Name | 9-hydroxy-4-[2-(trifluoromethyl)phenyl]-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
|---|---|
| PubChem CID | 11844609 |
| Molecular Formula | C21H11F3N2O3 |
| Molecular Weight | 396.32 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 9-hydroxy-4-[2-(trifluoromethyl)phenyl]-6H-pyrrolo[3,4-c]carbazole-1,3-dione |
| SMILES | O=C1NC(=O)c2c1c(-c1ccccc1C(F)(F)F)cc1[nH]c3ccc(O)cc3c21 |
| InChI | InChI=1S/C21H11F3N2O3/c22-21(23,24)13-4-2-1-3-10(13)11-8-15-16(18-17(11)19(28)26-20(18)29)12-7-9(27)5-6-14(12)25-15/h1-8,25,27H,(H,26,28,29) |
| InChIKey | LLSKCTDKJYZJNL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.32 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|