About ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate
ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate (PubChem CID 118446199) has the molecular formula C22H27F2NO3
and a molecular weight of 391.46 g/mol. Its IUPAC name is ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate.
Molecular Properties
| Compound Name | ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate |
| PubChem CID | 118446199 |
| Molecular Formula | C22H27F2NO3 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate |
| SMILES | CCOC(=O)C(F)(F)[C@H](O)[C@@H](CC)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H27F2NO3/c1-3-19(20(26)22(23,24)21(27)28-4-2)25(15-17-11-7-5-8-12-17)16-18-13-9-6-10-14-18/h5-14,19-20,26H,3-4,15-16H2,1-2H3/t19-,20-/m1/s1 |
| InChIKey | XOOZOKXODBJIMO-WOJBJXKFSA-N |
| XLogP | 4.03 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate?
The IUPAC name of ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate (CID 118446199) is ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate.
What is the SMILES notation for ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate?
The canonical SMILES for ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate is CCOC(=O)C(F)(F)[C@H](O)[C@@H](CC)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate?
The InChIKey is XOOZOKXODBJIMO-WOJBJXKFSA-N. The full InChI is InChI=1S/C22H27F2NO3/c1-3-19(20(26)22(23,24)21(27)28-4-2)25(15-17-11-7-5-8-12-17)16-18-13-9-6-10-14-18/h5-14,19-20,26H,3-4,15-16H2,1-2H3/t19-,20-/m1/s1.
What are the key properties of ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate?
ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate has a molecular weight of 391.46 g/mol, XLogP of 4.03, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3R,4R)-4-(dibenzylamino)-2,2-difluoro-3-hydroxyhexanoate is sourced from PubChem (CID 118446199), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).