C20H27FN4O4 — CID 118446271
5-fluoro-6-[N-methyl-4-[[4-(methylamino)phenyl]diazenyl]anilino]hexane-1,2,3,4-tetrol (PubChem CID 118446271) has the molecular formula C20H27FN4O4 and a molecular weight of 406.46 g/mol. Its IUPAC name is 5-fluoro-6-[N-methyl-4-[[4-(methylamino)phenyl]diazenyl]anilino]hexane-1,2,3,4-tetrol.
| Compound Name | 5-fluoro-6-[N-methyl-4-[[4-(methylamino)phenyl]diazenyl]anilino]hexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 118446271 |
| Molecular Formula | C20H27FN4O4 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 5-fluoro-6-[N-methyl-4-[[4-(methylamino)phenyl]diazenyl]anilino]hexane-1,2,3,4-tetrol |
| SMILES | CNc1ccc(/N=N/c2ccc(N(C)CC(F)C(O)C(O)C(O)CO)cc2)cc1 |
| InChI | InChI=1S/C20H27FN4O4/c1-22-13-3-5-14(6-4-13)23-24-15-7-9-16(10-8-15)25(2)11-17(21)19(28)20(29)18(27)12-26/h3-10,17-20,22,26-29H,11-12H2,1-2H3/b24-23+ |
| InChIKey | LJMLZDHXKYVVNM-WCWDXBQESA-N |
| XLogP | 1.99 |
| TPSA | 120.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|