About 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol
5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol (PubChem CID 118446404) has the molecular formula C19H32O3
and a molecular weight of 308.46 g/mol. Its IUPAC name is 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol.
Molecular Properties
| Compound Name | 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol |
| PubChem CID | 118446404 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol |
| SMILES | CCC(C)c1ccc(OC(CC(C)(C)C)OC(C)C)c(O)c1 |
| InChI | InChI=1S/C19H32O3/c1-8-14(4)15-9-10-17(16(20)11-15)22-18(21-13(2)3)12-19(5,6)7/h9-11,13-14,18,20H,8,12H2,1-7H3 |
| InChIKey | ZZBGGTVAPSXPLL-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol?
The IUPAC name of 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol (CID 118446404) is 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol.
What is the SMILES notation for 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol?
The canonical SMILES for 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol is CCC(C)c1ccc(OC(CC(C)(C)C)OC(C)C)c(O)c1.
What is the InChIKey of 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol?
The InChIKey is ZZBGGTVAPSXPLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32O3/c1-8-14(4)15-9-10-17(16(20)11-15)22-18(21-13(2)3)12-19(5,6)7/h9-11,13-14,18,20H,8,12H2,1-7H3.
What are the key properties of 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol?
5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol has a molecular weight of 308.46 g/mol, XLogP of 5.47, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butan-2-yl-2-(3,3-dimethyl-1-propan-2-yloxybutoxy)phenol is sourced from PubChem (CID 118446404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).