C17H20N4 — CID 118447347
1-cyclohexyl-3-[(3E)-hexa-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidine (PubChem CID 118447347) has the molecular formula C17H20N4 and a molecular weight of 280.38 g/mol. Its IUPAC name is 1-cyclohexyl-3-[(3E)-hexa-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidine.
| Compound Name | 1-cyclohexyl-3-[(3E)-hexa-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 118447347 |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | 1-cyclohexyl-3-[(3E)-hexa-1,3,5-trien-3-yl]pyrazolo[3,4-d]pyrimidine |
| SMILES | C=C/C=C(\C=C)c1nn(C2CCCCC2)c2ncncc12 |
| InChI | InChI=1S/C17H20N4/c1-3-8-13(4-2)16-15-11-18-12-19-17(15)21(20-16)14-9-6-5-7-10-14/h3-4,8,11-12,14H,1-2,5-7,9-10H2/b13-8+ |
| InChIKey | HJCNDHRREFAUSD-MDWZMJQESA-N |
| XLogP | 4.09 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|