About 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane
4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane (PubChem CID 118447639) has the molecular formula C11H18OS
and a molecular weight of 198.33 g/mol. Its IUPAC name is 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane.
Molecular Properties
| Compound Name | 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane |
| PubChem CID | 118447639 |
| Molecular Formula | C11H18OS |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane |
| SMILES | COC1CC(C)(/C=C/C=C(C)C)S1 |
| InChI | InChI=1S/C11H18OS/c1-9(2)6-5-7-11(3)8-10(12-4)13-11/h5-7,10H,8H2,1-4H3/b7-5+ |
| InChIKey | RKGBTUHIIMAIKJ-FNORWQNLSA-N |
| XLogP | 3.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane?
The IUPAC name of 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane (CID 118447639) is 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane.
What is the SMILES notation for 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane?
The canonical SMILES for 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane is COC1CC(C)(/C=C/C=C(C)C)S1.
What is the InChIKey of 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane?
The InChIKey is RKGBTUHIIMAIKJ-FNORWQNLSA-N. The full InChI is InChI=1S/C11H18OS/c1-9(2)6-5-7-11(3)8-10(12-4)13-11/h5-7,10H,8H2,1-4H3/b7-5+.
What are the key properties of 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane?
4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane has a molecular weight of 198.33 g/mol, XLogP of 3.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2-methyl-2-[(1E)-4-methylpenta-1,3-dienyl]thietane is sourced from PubChem (CID 118447639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).