About (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol
(2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol (PubChem CID 118447832) has the molecular formula C14H23NO
and a molecular weight of 221.34 g/mol. Its IUPAC name is (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol.
Molecular Properties
| Compound Name | (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol |
| PubChem CID | 118447832 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol |
| SMILES | C=C/C=C(\C)[C@@H](O)CNCCC(=C)/C=C\C |
| InChI | InChI=1S/C14H23NO/c1-5-7-12(3)9-10-15-11-14(16)13(4)8-6-2/h5-8,14-16H,2-3,9-11H2,1,4H3/b7-5-,13-8+/t14-/m0/s1 |
| InChIKey | YRQWNFFULYLSDK-JQCQKJQXSA-N |
| XLogP | 2.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol?
The IUPAC name of (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol (CID 118447832) is (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol.
What is the SMILES notation for (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol?
The canonical SMILES for (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol is C=C/C=C(\C)[C@@H](O)CNCCC(=C)/C=C\C.
What is the InChIKey of (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol?
The InChIKey is YRQWNFFULYLSDK-JQCQKJQXSA-N. The full InChI is InChI=1S/C14H23NO/c1-5-7-12(3)9-10-15-11-14(16)13(4)8-6-2/h5-8,14-16H,2-3,9-11H2,1,4H3/b7-5-,13-8+/t14-/m0/s1.
What are the key properties of (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol?
(2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol has a molecular weight of 221.34 g/mol, XLogP of 2.59, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3E)-3-methyl-1-[[(Z)-3-methylidenehex-4-enyl]amino]hexa-3,5-dien-2-ol is sourced from PubChem (CID 118447832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).