About 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one
3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one (PubChem CID 118447862) has the molecular formula C9H16F2N2O
and a molecular weight of 206.24 g/mol. Its IUPAC name is 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one.
Molecular Properties
| Compound Name | 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one |
| PubChem CID | 118447862 |
| Molecular Formula | C9H16F2N2O |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.12 |
| IUPAC Name | 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one |
| SMILES | CC1(C)CCN(C(=O)C(F)(F)CN)C1 |
| InChI | InChI=1S/C9H16F2N2O/c1-8(2)3-4-13(6-8)7(14)9(10,11)5-12/h3-6,12H2,1-2H3 |
| InChIKey | XGHUSPLIMYKTTF-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one?
The IUPAC name of 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one (CID 118447862) is 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one.
What is the SMILES notation for 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one?
The canonical SMILES for 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one is CC1(C)CCN(C(=O)C(F)(F)CN)C1.
What is the InChIKey of 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one?
The InChIKey is XGHUSPLIMYKTTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16F2N2O/c1-8(2)3-4-13(6-8)7(14)9(10,11)5-12/h3-6,12H2,1-2H3.
What are the key properties of 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one?
3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one has a molecular weight of 206.24 g/mol, XLogP of 0.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-1-(3,3-dimethylpyrrolidin-1-yl)-2,2-difluoropropan-1-one is sourced from PubChem (CID 118447862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).