About 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine
6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine (PubChem CID 118447998) has the molecular formula C19H11ClF2N4
and a molecular weight of 368.77 g/mol. Its IUPAC name is 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine.
Molecular Properties
| Compound Name | 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine |
| PubChem CID | 118447998 |
| Molecular Formula | C19H11ClF2N4 |
| Molecular Weight | 368.77 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine |
| SMILES | Nc1ncnc2ccc(-c3cccnc3-c3ccc(F)c(Cl)c3F)cc12 |
| InChI | InChI=1S/C19H11ClF2N4/c20-16-14(21)5-4-12(17(16)22)18-11(2-1-7-24-18)10-3-6-15-13(8-10)19(23)26-9-25-15/h1-9H,(H2,23,25,26) |
| InChIKey | FTERQQKLNYBGKV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.77 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine?
The IUPAC name of 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine (CID 118447998) is 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine.
What is the SMILES notation for 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine?
The canonical SMILES for 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine is Nc1ncnc2ccc(-c3cccnc3-c3ccc(F)c(Cl)c3F)cc12.
What is the InChIKey of 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine?
The InChIKey is FTERQQKLNYBGKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H11ClF2N4/c20-16-14(21)5-4-12(17(16)22)18-11(2-1-7-24-18)10-3-6-15-13(8-10)19(23)26-9-25-15/h1-9H,(H2,23,25,26).
What are the key properties of 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine?
6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine has a molecular weight of 368.77 g/mol, XLogP of 4.87, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-chloro-2,4-difluorophenyl)-3-pyridinyl]quinazolin-4-amine is sourced from PubChem (CID 118447998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).