About 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole
6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole (PubChem CID 118448001) has the molecular formula C20H14N2S
and a molecular weight of 314.41 g/mol. Its IUPAC name is 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole |
| PubChem CID | 118448001 |
| Molecular Formula | C20H14N2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole |
| SMILES | C#Cc1cccc(-c2ncccc2-c2ccc3c(c2)SCN3)c1 |
| InChI | InChI=1S/C20H14N2S/c1-2-14-5-3-6-16(11-14)20-17(7-4-10-21-20)15-8-9-18-19(12-15)23-13-22-18/h1,3-12,22H,13H2 |
| InChIKey | UWSPDJMUUIISBL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole?
The IUPAC name of 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole (CID 118448001) is 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole.
What is the SMILES notation for 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole?
The canonical SMILES for 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole is C#Cc1cccc(-c2ncccc2-c2ccc3c(c2)SCN3)c1.
What is the InChIKey of 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole?
The InChIKey is UWSPDJMUUIISBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14N2S/c1-2-14-5-3-6-16(11-14)20-17(7-4-10-21-20)15-8-9-18-19(12-15)23-13-22-18/h1,3-12,22H,13H2.
What are the key properties of 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole?
6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole has a molecular weight of 314.41 g/mol, XLogP of 4.87, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[2-(3-ethynylphenyl)-3-pyridinyl]-2,3-dihydro-1,3-benzothiazole is sourced from PubChem (CID 118448001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).